Urolithin B (1139-83-9) Kilang pengeluar

Urolithin B

November 9, 2020

Urolithin BSpecifications

Nama: Urolithin B
Nama kimia: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Formula kimia: C13H8O3
Berat molekul: 212.2 g / mol
Warna:  Serbuk putih
Kekunci InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kod SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Fungsi: Urolithin B dapat meningkatkan fungsi mitokondria dan otot.

Urolithin B dapat meningkatkan kekuatan dan daya tahan otot semasa penuaan.

Permohonan: Urolithin B adalah metabolit mikroba usus dari ellagitannis dan menunjukkan aktiviti anti-oksidan dan pro-oksidan yang kuat bergantung pada sistem dan keadaan ujian. Urolithin B juga dapat menunjukkan aktiviti estrogenik dan / atau anti-estrogenik.
Kelarutan: Mudah larut dalam N, N-dimethylformamide dan dimethylmethylene. Sulfone, sedikit larut dalam metanol, etanol, dan etil asetat
Tempatan Penyimpanan: Hygroscopic, -20 ° C Freezer, Di bawah suasana tidak aktif
Keadaan Penghantaran: Dihantar di bawah suhu ambien sebagai bahan kimia yang tidak berbahaya. Produk ini cukup stabil untuk beberapa minggu semasa penghantaran biasa dan masa yang dibelanjakan dalam Kastam.